C19H21NO9 — CID 10386671
acetyl 2-acetyloxy-5-[(6-acetyloxy-6-oxohexanoyl)amino]benzoate (PubChem CID 10386671) has the molecular formula C19H21NO9 and a molecular weight of 407.38 g/mol. Its IUPAC name is acetyl 2-acetyloxy-5-[(6-acetyloxy-6-oxohexanoyl)amino]benzoate.
| Compound Name | acetyl 2-acetyloxy-5-[(6-acetyloxy-6-oxohexanoyl)amino]benzoate |
|---|---|
| PubChem CID | 10386671 |
| Molecular Formula | C19H21NO9 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | acetyl 2-acetyloxy-5-[(6-acetyloxy-6-oxohexanoyl)amino]benzoate |
| SMILES | CC(=O)OC(=O)CCCCC(=O)Nc1ccc(OC(C)=O)c(C(=O)OC(C)=O)c1 |
| InChI | InChI=1S/C19H21NO9/c1-11(21)27-16-9-8-14(10-15(16)19(26)29-13(3)23)20-17(24)6-4-5-7-18(25)28-12(2)22/h8-10H,4-7H2,1-3H3,(H,20,24) |
| InChIKey | IZFOUFNZBCRXCM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|