C51H67NO5 — CID 77446144
5-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-docosa-4,7,10,13,16,19-hexaenoyloxybenzoic acid (PubChem CID 77446144) has the molecular formula C51H67NO5 and a molecular weight of 774.10 g/mol. Its IUPAC name is 5-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-docosa-4,7,10,13,16,19-hexaenoyloxybenzoic acid.
| Compound Name | 5-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-docosa-4,7,10,13,16,19-hexaenoyloxybenzoic acid |
|---|---|
| PubChem CID | 77446144 |
| Molecular Formula | C51H67NO5 |
| Molecular Weight | 774.10 g/mol |
| Exact Mass | 773.50 |
| IUPAC Name | 5-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-docosa-4,7,10,13,16,19-hexaenoyloxybenzoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)Nc1ccc(OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC)c(C(=O)O)c1 |
| InChI | InChI=1S/C51H67NO5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-49(53)52-46-43-44-48(47(45-46)51(55)56)57-50(54)42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,23-26,29-32,35-38,43-45H,3-4,9-10,15-16,21-22,27-28,33-34,39-42H2,1-2H3,(H,52,53)(H,55,56) |
| InChIKey | MRVVAEWNKWSUEM-UHFFFAOYSA-N |
| XLogP | 14.18 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.10 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|