C19H15F4NO5 — CID 142683884
methyl 2-acetyloxy-5-[[2-[5-fluoro-2-(trifluoromethyl)phenyl]acetyl]amino]benzoate (PubChem CID 142683884) has the molecular formula C19H15F4NO5 and a molecular weight of 413.32 g/mol. Its IUPAC name is methyl 2-acetyloxy-5-[[2-[5-fluoro-2-(trifluoromethyl)phenyl]acetyl]amino]benzoate.
| Compound Name | methyl 2-acetyloxy-5-[[2-[5-fluoro-2-(trifluoromethyl)phenyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 142683884 |
| Molecular Formula | C19H15F4NO5 |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | methyl 2-acetyloxy-5-[[2-[5-fluoro-2-(trifluoromethyl)phenyl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)Cc2cc(F)ccc2C(F)(F)F)ccc1OC(C)=O |
| InChI | InChI=1S/C19H15F4NO5/c1-10(25)29-16-6-4-13(9-14(16)18(27)28-2)24-17(26)8-11-7-12(20)3-5-15(11)19(21,22)23/h3-7,9H,8H2,1-2H3,(H,24,26) |
| InChIKey | KZHGXGVAYHQJES-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|