C18H17F2NO4 — CID 142683865
methyl 2-acetyloxy-5-[2-(3,5-difluorophenyl)ethylamino]benzoate (PubChem CID 142683865) has the molecular formula C18H17F2NO4 and a molecular weight of 349.33 g/mol. Its IUPAC name is methyl 2-acetyloxy-5-[2-(3,5-difluorophenyl)ethylamino]benzoate.
| Compound Name | methyl 2-acetyloxy-5-[2-(3,5-difluorophenyl)ethylamino]benzoate |
|---|---|
| PubChem CID | 142683865 |
| Molecular Formula | C18H17F2NO4 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | methyl 2-acetyloxy-5-[2-(3,5-difluorophenyl)ethylamino]benzoate |
| SMILES | COC(=O)c1cc(NCCc2cc(F)cc(F)c2)ccc1OC(C)=O |
| InChI | InChI=1S/C18H17F2NO4/c1-11(22)25-17-4-3-15(10-16(17)18(23)24-2)21-6-5-12-7-13(19)9-14(20)8-12/h3-4,7-10,21H,5-6H2,1-2H3 |
| InChIKey | QCLAQIFSIXGIJO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|