C23H21FN2O7S2 — CID 143199728
S-(2,3-dinitrooxypropyl) 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]ethanethioate (PubChem CID 143199728) has the molecular formula C23H21FN2O7S2 and a molecular weight of 520.56 g/mol. Its IUPAC name is S-(2,3-dinitrooxypropyl) 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]ethanethioate.
| Compound Name | S-(2,3-dinitrooxypropyl) 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]ethanethioate |
|---|---|
| PubChem CID | 143199728 |
| Molecular Formula | C23H21FN2O7S2 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | S-(2,3-dinitrooxypropyl) 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]ethanethioate |
| SMILES | CSc1ccc(/C=C2/C(C)=C(CC(=O)SCC(CO[N+](=O)[O-])O[N+](=O)[O-])c3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C23H21FN2O7S2/c1-14-20(9-15-3-6-18(34-2)7-4-15)19-8-5-16(24)10-22(19)21(14)11-23(27)35-13-17(33-26(30)31)12-32-25(28)29/h3-10,17H,11-13H2,1-2H3/b20-9- |
| InChIKey | RETFJOJRGKHGGP-UKWGHVSLSA-N |
| XLogP | 5.31 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|