C21H19FO2S — CID 10089492
2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]propanoic acid (PubChem CID 10089492) has the molecular formula C21H19FO2S and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]propanoic acid.
| Compound Name | 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]propanoic acid |
|---|---|
| PubChem CID | 10089492 |
| Molecular Formula | C21H19FO2S |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]propanoic acid |
| SMILES | CSc1ccc(/C=C2/C(C)=C(C(C)C(=O)O)c3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C21H19FO2S/c1-12-18(10-14-4-7-16(25-3)8-5-14)17-9-6-15(22)11-19(17)20(12)13(2)21(23)24/h4-11,13H,1-3H3,(H,23,24)/b18-10- |
| InChIKey | MLXUCJJUPYODRC-ZDLGFXPLSA-N |
| XLogP | 5.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|