C24H20FNO5S — CID 172820602
2-(2,5-dioxopyrrolidin-1-yl)-2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetic acid (PubChem CID 172820602) has the molecular formula C24H20FNO5S and a molecular weight of 453.49 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetic acid.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 172820602 |
| Molecular Formula | C24H20FNO5S |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetic acid |
| SMILES | CC1=C(C(C(=O)O)N2C(=O)CCC2=O)c2cc(F)ccc2/C1=C\c1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C24H20FNO5S/c1-13-18(11-14-3-6-16(7-4-14)32(2)31)17-8-5-15(25)12-19(17)22(13)23(24(29)30)26-20(27)9-10-21(26)28/h3-8,11-12,23H,9-10H2,1-2H3,(H,29,30)/b18-11- |
| InChIKey | UECWEIWJIIMLRR-WQRHYEAKSA-N |
| XLogP | 3.49 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|