C20H17FO3S — CID 154218934
2-fluoro-2-[2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetic acid (PubChem CID 154218934) has the molecular formula C20H17FO3S and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-fluoro-2-[2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetic acid.
| Compound Name | 2-fluoro-2-[2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 154218934 |
| Molecular Formula | C20H17FO3S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-fluoro-2-[2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetic acid |
| SMILES | CC1=C(C(F)C(=O)O)c2ccccc2C1=Cc1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C20H17FO3S/c1-12-17(11-13-7-9-14(10-8-13)25(2)24)15-5-3-4-6-16(15)18(12)19(21)20(22)23/h3-11,19H,1-2H3,(H,22,23) |
| InChIKey | WQRYMXKJHQGREU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|