C33H31FO5S2 — CID 90323526
[(3Z)-1-[2-(4-ethanethioylphenoxy)-2-oxoethyl]-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-5-yl] pentanoate (PubChem CID 90323526) has the molecular formula C33H31FO5S2 and a molecular weight of 590.74 g/mol. Its IUPAC name is [(3Z)-1-[2-(4-ethanethioylphenoxy)-2-oxoethyl]-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-5-yl] pentanoate.
| Compound Name | [(3Z)-1-[2-(4-ethanethioylphenoxy)-2-oxoethyl]-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-5-yl] pentanoate |
|---|---|
| PubChem CID | 90323526 |
| Molecular Formula | C33H31FO5S2 |
| Molecular Weight | 590.74 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | [(3Z)-1-[2-(4-ethanethioylphenoxy)-2-oxoethyl]-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-5-yl] pentanoate |
| SMILES | CCCCC(=O)Oc1cc2c(cc1F)C(CC(=O)Oc1ccc(C(C)=S)cc1)=C(C)/C2=C/c1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C33H31FO5S2/c1-5-6-7-32(35)39-31-18-29-26(16-22-8-14-25(15-9-22)41(4)37)20(2)27(28(29)17-30(31)34)19-33(36)38-24-12-10-23(11-13-24)21(3)40/h8-18H,5-7,19H2,1-4H3/b26-16- |
| InChIKey | BQYNJAAOMYYBPF-QQXSKIMKSA-N |
| XLogP | 7.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.74 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|