C29H27FN2O4S — CID 161371723
N-[(2,4-dimethoxyphenyl)methylideneamino]-2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetamide (PubChem CID 161371723) has the molecular formula C29H27FN2O4S and a molecular weight of 518.61 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methylideneamino]-2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methylideneamino]-2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetamide |
|---|---|
| PubChem CID | 161371723 |
| Molecular Formula | C29H27FN2O4S |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methylideneamino]-2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetamide |
| SMILES | COc1ccc(C=NNC(=O)CC2=C(C)/C(=C/c3ccc(S(C)=O)cc3)c3ccc(F)cc32)c(OC)c1 |
| InChI | InChI=1S/C29H27FN2O4S/c1-18-25(13-19-5-10-23(11-6-19)37(4)34)24-12-8-21(30)14-27(24)26(18)16-29(33)32-31-17-20-7-9-22(35-2)15-28(20)36-3/h5-15,17H,16H2,1-4H3,(H,32,33)/b25-13-,31-17? |
| InChIKey | VQNWEUBBHWPHID-YJPXXRQWSA-N |
| XLogP | 5.45 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|