C27H23FN2O3S — CID 138690924
2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]-N-[(Z)-(4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 138690924) has the molecular formula C27H23FN2O3S and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]-N-[(Z)-(4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]-N-[(Z)-(4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 138690924 |
| Molecular Formula | C27H23FN2O3S |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]-N-[(Z)-(4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | CC1=C(CC(=O)N/N=C\c2ccc(O)cc2)c2cc(F)ccc2/C1=C\c1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C27H23FN2O3S/c1-17-24(13-18-5-10-22(11-6-18)34(2)33)23-12-7-20(28)14-26(23)25(17)15-27(32)30-29-16-19-3-8-21(31)9-4-19/h3-14,16,31H,15H2,1-2H3,(H,30,32)/b24-13-,29-16- |
| InChIKey | MRDBHRASEFADKO-RPJXGSBUSA-N |
| XLogP | 5.14 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|