C27H25BFNO5S — CID 142365718
[4-[[[2-[(3E)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]amino]oxymethyl]phenyl]boronic acid (PubChem CID 142365718) has the molecular formula C27H25BFNO5S and a molecular weight of 505.38 g/mol. Its IUPAC name is [4-[[[2-[(3E)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]amino]oxymethyl]phenyl]boronic acid.
| Compound Name | [4-[[[2-[(3E)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]amino]oxymethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 142365718 |
| Molecular Formula | C27H25BFNO5S |
| Molecular Weight | 505.38 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | [4-[[[2-[(3E)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]amino]oxymethyl]phenyl]boronic acid |
| SMILES | CC1=C(CC(=O)NOCc2ccc(B(O)O)cc2)c2cc(F)ccc2/C1=C/c1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C27H25BFNO5S/c1-17-24(13-18-5-10-22(11-6-18)36(2)34)23-12-9-21(29)14-26(23)25(17)15-27(31)30-35-16-19-3-7-20(8-4-19)28(32)33/h3-14,32-33H,15-16H2,1-2H3,(H,30,31)/b24-13+ |
| InChIKey | DDVOTCAQPXDMCV-ZMOGYAJESA-N |
| XLogP | 3.21 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|