C32H33FN2O5S3Y-2 — CID 58608041
2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]-N-phenylacetamide;2-(2-methoxyethyldisulfanyl)ethoxycarbonylazanide;yttrium (PubChem CID 58608041) has the molecular formula C32H33FN2O5S3Y-2 and a molecular weight of 729.73 g/mol. Its IUPAC name is 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]-N-phenylacetamide;2-(2-methoxyethyldisulfanyl)ethoxycarbonylazanide;yttrium.
| Compound Name | 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]-N-phenylacetamide;2-(2-methoxyethyldisulfanyl)ethoxycarbonylazanide;yttrium |
|---|---|
| PubChem CID | 58608041 |
| Molecular Formula | C32H33FN2O5S3Y-2 |
| Molecular Weight | 729.73 g/mol |
| Exact Mass | 729.06 |
| IUPAC Name | 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]-N-phenylacetamide;2-(2-methoxyethyldisulfanyl)ethoxycarbonylazanide;yttrium |
| SMILES | CC1=C(CC(=O)Nc2cc[c-]cc2)c2cc(F)ccc2/C1=C\c1ccc(S(C)=O)cc1.COCCSSCCOC([NH-])=O.[Y] |
| InChI | InChI=1S/C26H21FNO2S.C6H13NO3S2.Y/c1-17-23(14-18-8-11-21(12-9-18)31(2)30)22-13-10-19(27)15-25(22)24(17)16-26(29)28-20-6-4-3-5-7-20;1-9-2-4-11-12-5-3-10-6(7)8;/h4-15H,16H2,1-2H3,(H,28,29);2-5H2,1H3,(H2,7,8);/q-1;;/p-1/b23-14-;; |
| InChIKey | XWFAWAJRUZCREY-ARWHCIRMSA-M |
| XLogP | 7.92 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.73 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|