C22H36N2O4S — CID 57324152
7-[(1S,2S,3S,4R)-3-[[[3-(pentylamino)-3-sulfanylidenepropanoyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-2-enoic acid (PubChem CID 57324152) has the molecular formula C22H36N2O4S and a molecular weight of 424.61 g/mol. Its IUPAC name is 7-[(1S,2S,3S,4R)-3-[[[3-(pentylamino)-3-sulfanylidenepropanoyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-2-enoic acid.
| Compound Name | 7-[(1S,2S,3S,4R)-3-[[[3-(pentylamino)-3-sulfanylidenepropanoyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-2-enoic acid |
|---|---|
| PubChem CID | 57324152 |
| Molecular Formula | C22H36N2O4S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 7-[(1S,2S,3S,4R)-3-[[[3-(pentylamino)-3-sulfanylidenepropanoyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-2-enoic acid |
| SMILES | CCCCCNC(=S)CC(=O)NC[C@@H]1[C@H](CCCCC=CC(=O)O)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C22H36N2O4S/c1-2-3-8-13-23-21(29)14-20(25)24-15-17-16(18-11-12-19(17)28-18)9-6-4-5-7-10-22(26)27/h7,10,16-19H,2-6,8-9,11-15H2,1H3,(H,23,29)(H,24,25)(H,26,27)/t16-,17+,18-,19+/m0/s1 |
| InChIKey | PGORYOHIMHEOOX-ZSYWTGECSA-N |
| XLogP | 3.59 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|