C22H37N3O6 — CID 54173627
[(1S,2R,3R,4R)-3-[7-[hydroxy(methyl)amino]-7-oxohept-2-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl N-[2-(butylamino)-2-oxoethyl]carbamate (PubChem CID 54173627) has the molecular formula C22H37N3O6 and a molecular weight of 439.55 g/mol. Its IUPAC name is [(1S,2R,3R,4R)-3-[7-[hydroxy(methyl)amino]-7-oxohept-2-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl N-[2-(butylamino)-2-oxoethyl]carbamate.
| Compound Name | [(1S,2R,3R,4R)-3-[7-[hydroxy(methyl)amino]-7-oxohept-2-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl N-[2-(butylamino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 54173627 |
| Molecular Formula | C22H37N3O6 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | [(1S,2R,3R,4R)-3-[7-[hydroxy(methyl)amino]-7-oxohept-2-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl N-[2-(butylamino)-2-oxoethyl]carbamate |
| SMILES | CCCCNC(=O)CNC(=O)OC[C@H]1[C@@H](CC=CCCCC(=O)N(C)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C22H37N3O6/c1-3-4-13-23-20(26)14-24-22(28)30-15-17-16(18-11-12-19(17)31-18)9-7-5-6-8-10-21(27)25(2)29/h5,7,16-19,29H,3-4,6,8-15H2,1-2H3,(H,23,26)(H,24,28)/t16-,17+,18-,19+/m1/s1 |
| InChIKey | OWSLHSFBVXQMKT-HCXYKTFWSA-N |
| XLogP | 2.39 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|