C22H36O3S — CID 54017741
7-[(1S,2S,3R,4R)-3-(cyclohexylmethylsulfinylmethyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 54017741) has the molecular formula C22H36O3S and a molecular weight of 380.59 g/mol. Its IUPAC name is 7-[(1S,2S,3R,4R)-3-(cyclohexylmethylsulfinylmethyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | 7-[(1S,2S,3R,4R)-3-(cyclohexylmethylsulfinylmethyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54017741 |
| Molecular Formula | C22H36O3S |
| Molecular Weight | 380.59 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 7-[(1S,2S,3R,4R)-3-(cyclohexylmethylsulfinylmethyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1[C@H]2CC[C@H](C2)[C@H]1CS(=O)CC1CCCCC1 |
| InChI | InChI=1S/C22H36O3S/c23-22(24)11-7-2-1-6-10-20-18-12-13-19(14-18)21(20)16-26(25)15-17-8-4-3-5-9-17/h1,6,17-21H,2-5,7-16H2,(H,23,24)/t18-,19+,20-,21+,26?/m0/s1 |
| InChIKey | KWTSEWPSDKFZDW-CZGRQRKNSA-N |
| XLogP | 5.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|