C14H18O5 — CID 88676123
(Z)-7-[(1S,2R,4S,5R,6S,7R)-7-formyl-3,8-dioxatricyclo[3.2.1.02,4]octan-6-yl]hept-5-enoic acid (PubChem CID 88676123) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (Z)-7-[(1S,2R,4S,5R,6S,7R)-7-formyl-3,8-dioxatricyclo[3.2.1.02,4]octan-6-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2R,4S,5R,6S,7R)-7-formyl-3,8-dioxatricyclo[3.2.1.02,4]octan-6-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 88676123 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (Z)-7-[(1S,2R,4S,5R,6S,7R)-7-formyl-3,8-dioxatricyclo[3.2.1.02,4]octan-6-yl]hept-5-enoic acid |
| SMILES | O=C[C@@H]1[C@H](C/C=C\CCCC(=O)O)[C@H]2O[C@@H]1[C@H]1O[C@H]12 |
| InChI | InChI=1S/C14H18O5/c15-7-9-8(5-3-1-2-4-6-10(16)17)11-13-14(19-13)12(9)18-11/h1,3,7-9,11-14H,2,4-6H2,(H,16,17)/b3-1-/t8-,9+,11+,12-,13-,14+/m0/s1 |
| InChIKey | IEDMOEWYUIQODO-NMPPZPFKSA-N |
| XLogP | 1.17 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|