C20H32O5 — CID 140526543
7-[(2R,3R)-4-hydroxy-3-(3-hydroxyoct-1-enyl)-6-oxabicyclo[3.1.0]hexan-2-yl]hept-5-enoic acid (PubChem CID 140526543) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is 7-[(2R,3R)-4-hydroxy-3-(3-hydroxyoct-1-enyl)-6-oxabicyclo[3.1.0]hexan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(2R,3R)-4-hydroxy-3-(3-hydroxyoct-1-enyl)-6-oxabicyclo[3.1.0]hexan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 140526543 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 7-[(2R,3R)-4-hydroxy-3-(3-hydroxyoct-1-enyl)-6-oxabicyclo[3.1.0]hexan-2-yl]hept-5-enoic acid |
| SMILES | CCCCCC(O)C=C[C@H]1C(O)C2OC2[C@@H]1CC=CCCCC(=O)O |
| InChI | InChI=1S/C20H32O5/c1-2-3-6-9-14(21)12-13-15-16(19-20(25-19)18(15)24)10-7-4-5-8-11-17(22)23/h4,7,12-16,18-21,24H,2-3,5-6,8-11H2,1H3,(H,22,23)/t14?,15-,16-,18?,19?,20?/m1/s1 |
| InChIKey | YAKPHMOQGDXUEH-VZYSRKDMSA-N |
| XLogP | 3.06 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|