C17H26O5 — CID 88677558
(Z)-7-[(1S,2R,4S,5R,6S,7S)-7-(propoxymethyl)-3,8-dioxatricyclo[3.2.1.02,4]octan-6-yl]hept-5-enoic acid (PubChem CID 88677558) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is (Z)-7-[(1S,2R,4S,5R,6S,7S)-7-(propoxymethyl)-3,8-dioxatricyclo[3.2.1.02,4]octan-6-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2R,4S,5R,6S,7S)-7-(propoxymethyl)-3,8-dioxatricyclo[3.2.1.02,4]octan-6-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 88677558 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (Z)-7-[(1S,2R,4S,5R,6S,7S)-7-(propoxymethyl)-3,8-dioxatricyclo[3.2.1.02,4]octan-6-yl]hept-5-enoic acid |
| SMILES | CCCOC[C@@H]1[C@H](C/C=C\CCCC(=O)O)[C@H]2O[C@@H]1[C@H]1O[C@H]12 |
| InChI | InChI=1S/C17H26O5/c1-2-9-20-10-12-11(7-5-3-4-6-8-13(18)19)14-16-17(22-16)15(12)21-14/h3,5,11-12,14-17H,2,4,6-10H2,1H3,(H,18,19)/b5-3-/t11-,12+,14+,15-,16-,17+/m0/s1 |
| InChIKey | JXBHTVPCBOUHLI-WDGFKDIGSA-N |
| XLogP | 2.39 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|