C21H28Cl2O4 — CID 58184502
7-[(1R,2R,3R,5R)-5-chloro-2-[(E)-2-[3-chloro-5-(hydroxymethyl)phenyl]ethenyl]-3-hydroxycyclopentyl]heptanoic acid (PubChem CID 58184502) has the molecular formula C21H28Cl2O4 and a molecular weight of 415.36 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5R)-5-chloro-2-[(E)-2-[3-chloro-5-(hydroxymethyl)phenyl]ethenyl]-3-hydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5R)-5-chloro-2-[(E)-2-[3-chloro-5-(hydroxymethyl)phenyl]ethenyl]-3-hydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 58184502 |
| Molecular Formula | C21H28Cl2O4 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 7-[(1R,2R,3R,5R)-5-chloro-2-[(E)-2-[3-chloro-5-(hydroxymethyl)phenyl]ethenyl]-3-hydroxycyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1[C@@H](/C=C/c2cc(Cl)cc(CO)c2)[C@H](O)C[C@H]1Cl |
| InChI | InChI=1S/C21H28Cl2O4/c22-16-10-14(9-15(11-16)13-24)7-8-18-17(19(23)12-20(18)25)5-3-1-2-4-6-21(26)27/h7-11,17-20,24-25H,1-6,12-13H2,(H,26,27)/b8-7+/t17-,18-,19-,20-/m1/s1 |
| InChIKey | MIYCVHKYRAZBCC-CCUKAZOQSA-N |
| XLogP | 4.88 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|