C26H39ClO5 — CID 70018532
7-[(1R,2R,3R,5R)-5-chloro-2-[(E,3R)-4-[3-(2-ethoxyethyl)phenyl]-3-hydroxybut-1-enyl]-3-hydroxycyclopentyl]heptanoic acid (PubChem CID 70018532) has the molecular formula C26H39ClO5 and a molecular weight of 467.05 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5R)-5-chloro-2-[(E,3R)-4-[3-(2-ethoxyethyl)phenyl]-3-hydroxybut-1-enyl]-3-hydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5R)-5-chloro-2-[(E,3R)-4-[3-(2-ethoxyethyl)phenyl]-3-hydroxybut-1-enyl]-3-hydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 70018532 |
| Molecular Formula | C26H39ClO5 |
| Molecular Weight | 467.05 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 7-[(1R,2R,3R,5R)-5-chloro-2-[(E,3R)-4-[3-(2-ethoxyethyl)phenyl]-3-hydroxybut-1-enyl]-3-hydroxycyclopentyl]heptanoic acid |
| SMILES | CCOCCc1cccc(C[C@@H](O)/C=C/[C@@H]2[C@@H](CCCCCCC(=O)O)[C@H](Cl)C[C@H]2O)c1 |
| InChI | InChI=1S/C26H39ClO5/c1-2-32-15-14-19-8-7-9-20(16-19)17-21(28)12-13-23-22(24(27)18-25(23)29)10-5-3-4-6-11-26(30)31/h7-9,12-13,16,21-25,28-29H,2-6,10-11,14-15,17-18H2,1H3,(H,30,31)/b13-12+/t21-,22+,23+,24+,25+/m0/s1 |
| InChIKey | MMMZMIFJZAYUDK-VIGSKEFFSA-N |
| XLogP | 4.75 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.05 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|