C23H39NO4 — CID 10150673
7-[1-[4-[1-(cyclopropylmethyl)cyclobutyl]-4-hydroxybutyl]-3-oxopyrrolidin-2-yl]heptanoic acid (PubChem CID 10150673) has the molecular formula C23H39NO4 and a molecular weight of 393.57 g/mol. Its IUPAC name is 7-[1-[4-[1-(cyclopropylmethyl)cyclobutyl]-4-hydroxybutyl]-3-oxopyrrolidin-2-yl]heptanoic acid.
| Compound Name | 7-[1-[4-[1-(cyclopropylmethyl)cyclobutyl]-4-hydroxybutyl]-3-oxopyrrolidin-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 10150673 |
| Molecular Formula | C23H39NO4 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | 7-[1-[4-[1-(cyclopropylmethyl)cyclobutyl]-4-hydroxybutyl]-3-oxopyrrolidin-2-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(=O)CCN1CCCC(O)C1(CC2CC2)CCC1 |
| InChI | InChI=1S/C23H39NO4/c25-20-12-16-24(19(20)7-3-1-2-4-9-22(27)28)15-5-8-21(26)23(13-6-14-23)17-18-10-11-18/h18-19,21,26H,1-17H2,(H,27,28) |
| InChIKey | JGHWPUQGDCHPGD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|