C22H37NO4 — CID 66993814
7-[1-[4-[1-(cyclopropylmethyl)cyclopropyl]-4-hydroxybutyl]-3-oxopyrrolidin-2-yl]heptanoic acid (PubChem CID 66993814) has the molecular formula C22H37NO4 and a molecular weight of 379.54 g/mol. Its IUPAC name is 7-[1-[4-[1-(cyclopropylmethyl)cyclopropyl]-4-hydroxybutyl]-3-oxopyrrolidin-2-yl]heptanoic acid.
| Compound Name | 7-[1-[4-[1-(cyclopropylmethyl)cyclopropyl]-4-hydroxybutyl]-3-oxopyrrolidin-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 66993814 |
| Molecular Formula | C22H37NO4 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | 7-[1-[4-[1-(cyclopropylmethyl)cyclopropyl]-4-hydroxybutyl]-3-oxopyrrolidin-2-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(=O)CCN1CCCC(O)C1(CC2CC2)CC1 |
| InChI | InChI=1S/C22H37NO4/c24-19-11-15-23(18(19)6-3-1-2-4-8-21(26)27)14-5-7-20(25)22(12-13-22)16-17-9-10-17/h17-18,20,25H,1-16H2,(H,26,27) |
| InChIKey | WVTHGXUGHSPXMU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|