C23H37NO4 — CID 77246889
methyl 7-[1-[4-[1-(cyclopropylmethyl)cyclopropyl]-4-hydroxybutyl]-3-oxopyrrolidin-2-yl]hept-5-enoate (PubChem CID 77246889) has the molecular formula C23H37NO4 and a molecular weight of 391.55 g/mol. Its IUPAC name is methyl 7-[1-[4-[1-(cyclopropylmethyl)cyclopropyl]-4-hydroxybutyl]-3-oxopyrrolidin-2-yl]hept-5-enoate.
| Compound Name | methyl 7-[1-[4-[1-(cyclopropylmethyl)cyclopropyl]-4-hydroxybutyl]-3-oxopyrrolidin-2-yl]hept-5-enoate |
|---|---|
| PubChem CID | 77246889 |
| Molecular Formula | C23H37NO4 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | methyl 7-[1-[4-[1-(cyclopropylmethyl)cyclopropyl]-4-hydroxybutyl]-3-oxopyrrolidin-2-yl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CCC1C(=O)CCN1CCCC(O)C1(CC2CC2)CC1 |
| InChI | InChI=1S/C23H37NO4/c1-28-22(27)9-5-3-2-4-7-19-20(25)12-16-24(19)15-6-8-21(26)23(13-14-23)17-18-10-11-18/h2,4,18-19,21,26H,3,5-17H2,1H3 |
| InChIKey | HDTQXYIKNCZVEZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|