C22H39NO5 — CID 91176674
methyl 7-[(2S)-3,3-dimethoxy-1-(3-oxooctyl)pyrrolidin-2-yl]hept-5-enoate (PubChem CID 91176674) has the molecular formula C22H39NO5 and a molecular weight of 397.56 g/mol. Its IUPAC name is methyl 7-[(2S)-3,3-dimethoxy-1-(3-oxooctyl)pyrrolidin-2-yl]hept-5-enoate.
| Compound Name | methyl 7-[(2S)-3,3-dimethoxy-1-(3-oxooctyl)pyrrolidin-2-yl]hept-5-enoate |
|---|---|
| PubChem CID | 91176674 |
| Molecular Formula | C22H39NO5 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | methyl 7-[(2S)-3,3-dimethoxy-1-(3-oxooctyl)pyrrolidin-2-yl]hept-5-enoate |
| SMILES | CCCCCC(=O)CCN1CCC(OC)(OC)[C@@H]1CC=CCCCC(=O)OC |
| InChI | InChI=1S/C22H39NO5/c1-5-6-9-12-19(24)15-17-23-18-16-22(27-3,28-4)20(23)13-10-7-8-11-14-21(25)26-2/h7,10,20H,5-6,8-9,11-18H2,1-4H3/t20-/m0/s1 |
| InChIKey | PIZURCSWIKXZTH-FQEVSTJZSA-N |
| XLogP | 3.88 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|