C41H73NO6SSi2 — CID 5477939
methyl (E)-7-[1-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-(dimethylamino)cyclopentyl]hept-5-enoate (PubChem CID 5477939) has the molecular formula C41H73NO6SSi2 and a molecular weight of 764.27 g/mol. Its IUPAC name is methyl (E)-7-[1-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-(dimethylamino)cyclopentyl]hept-5-enoate.
| Compound Name | methyl (E)-7-[1-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-(dimethylamino)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 5477939 |
| Molecular Formula | C41H73NO6SSi2 |
| Molecular Weight | 764.27 g/mol |
| Exact Mass | 763.47 |
| IUPAC Name | methyl (E)-7-[1-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-(dimethylamino)cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(/C=C/C1C(O[Si](C)(C)C(C)(C)C)CC(N(C)C)C1(C/C=C/CCCC(=O)OC)S(=O)(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C41H73NO6SSi2/c1-15-16-20-25-33(47-50(11,12)39(2,3)4)29-30-35-36(48-51(13,14)40(5,6)7)32-37(42(8)9)41(35,31-24-18-17-23-28-38(43)46-10)49(44,45)34-26-21-19-22-27-34/h18-19,21-22,24,26-27,29-30,33,35-37H,15-17,20,23,25,28,31-32H2,1-14H3/b24-18+,30-29+ |
| InChIKey | XBIXRZGJWFLAJF-SNANVGOHSA-N |
| XLogP | 10.36 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.27 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|