C40H65ClO4Si2 — CID 146027801
methyl 3-[3-[[(2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-5-chlorocyclopentyl]methyl]phenyl]propanoate (PubChem CID 146027801) has the molecular formula C40H65ClO4Si2 and a molecular weight of 701.58 g/mol. Its IUPAC name is methyl 3-[3-[[(2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-5-chlorocyclopentyl]methyl]phenyl]propanoate.
| Compound Name | methyl 3-[3-[[(2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-5-chlorocyclopentyl]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 146027801 |
| Molecular Formula | C40H65ClO4Si2 |
| Molecular Weight | 701.58 g/mol |
| Exact Mass | 700.41 |
| IUPAC Name | methyl 3-[3-[[(2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-5-chlorocyclopentyl]methyl]phenyl]propanoate |
| SMILES | CCCCCC(O[Si](C)(C)C(C)(C)C)c1ccc([C@@H]2C(Cc3cccc(CCC(=O)OC)c3)[C@H](Cl)C[C@@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C40H65ClO4Si2/c1-13-14-15-19-35(44-46(9,10)39(2,3)4)31-21-23-32(24-22-31)38-33(34(41)28-36(38)45-47(11,12)40(5,6)7)27-30-18-16-17-29(26-30)20-25-37(42)43-8/h16-18,21-24,26,33-36,38H,13-15,19-20,25,27-28H2,1-12H3/t33?,34-,35?,36+,38-/m1/s1 |
| InChIKey | BPRFYDZOYZLMIX-IGLXLDAYSA-N |
| XLogP | 11.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.58 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|