C27H35ClO3 — CID 89058938
3-[3-[[(1R,3R)-5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]methyl]phenyl]propanal (PubChem CID 89058938) has the molecular formula C27H35ClO3 and a molecular weight of 443.03 g/mol. Its IUPAC name is 3-[3-[[(1R,3R)-5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]methyl]phenyl]propanal.
| Compound Name | 3-[3-[[(1R,3R)-5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]methyl]phenyl]propanal |
|---|---|
| PubChem CID | 89058938 |
| Molecular Formula | C27H35ClO3 |
| Molecular Weight | 443.03 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 3-[3-[[(1R,3R)-5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]methyl]phenyl]propanal |
| SMILES | CCCCCC(O)c1ccc(C2[C@@H](Cc3cccc(CCC=O)c3)C(Cl)C[C@H]2O)cc1 |
| InChI | InChI=1S/C27H35ClO3/c1-2-3-4-10-25(30)21-11-13-22(14-12-21)27-23(24(28)18-26(27)31)17-20-8-5-7-19(16-20)9-6-15-29/h5,7-8,11-16,23-27,30-31H,2-4,6,9-10,17-18H2,1H3/t23-,24?,25?,26+,27?/m0/s1 |
| InChIKey | HDTGOAIINXJQOH-RBFDBVRQSA-N |
| XLogP | 5.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.03 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|