C24H37FO2 — CID 129084210
7-[(1R)-2-fluoro-5-(4-hexylphenyl)cyclopentyl]heptanoic acid (PubChem CID 129084210) has the molecular formula C24H37FO2 and a molecular weight of 376.56 g/mol. Its IUPAC name is 7-[(1R)-2-fluoro-5-(4-hexylphenyl)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R)-2-fluoro-5-(4-hexylphenyl)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 129084210 |
| Molecular Formula | C24H37FO2 |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 7-[(1R)-2-fluoro-5-(4-hexylphenyl)cyclopentyl]heptanoic acid |
| SMILES | CCCCCCc1ccc(C2CCC(F)[C@@H]2CCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C24H37FO2/c1-2-3-4-7-10-19-13-15-20(16-14-19)21-17-18-23(25)22(21)11-8-5-6-9-12-24(26)27/h13-16,21-23H,2-12,17-18H2,1H3,(H,26,27)/t21?,22-,23?/m1/s1 |
| InChIKey | FRYJIBSCFKCVJJ-OOMBGRCJSA-N |
| XLogP | 7.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|