C32H34O4 — CID 19830792
2-[4-[6-[6-methoxy-2-(4-methoxyphenyl)naphthalen-1-yl]hexyl]phenyl]acetic acid (PubChem CID 19830792) has the molecular formula C32H34O4 and a molecular weight of 482.62 g/mol. Its IUPAC name is 2-[4-[6-[6-methoxy-2-(4-methoxyphenyl)naphthalen-1-yl]hexyl]phenyl]acetic acid.
| Compound Name | 2-[4-[6-[6-methoxy-2-(4-methoxyphenyl)naphthalen-1-yl]hexyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 19830792 |
| Molecular Formula | C32H34O4 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 2-[4-[6-[6-methoxy-2-(4-methoxyphenyl)naphthalen-1-yl]hexyl]phenyl]acetic acid |
| SMILES | COc1ccc(-c2ccc3cc(OC)ccc3c2CCCCCCc2ccc(CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C32H34O4/c1-35-27-16-13-25(14-17-27)29-19-15-26-22-28(36-2)18-20-30(26)31(29)8-6-4-3-5-7-23-9-11-24(12-10-23)21-32(33)34/h9-20,22H,3-8,21H2,1-2H3,(H,33,34) |
| InChIKey | DGKLMYSXDMDRDL-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|