C37H44O6 — CID 178182940
(2S)-2-[1-[9-[2-[(1S)-1-carboxyethyl]-6-methoxynaphthalen-1-yl]nonyl]-6-methoxynaphthalen-2-yl]propanoic acid (PubChem CID 178182940) has the molecular formula C37H44O6 and a molecular weight of 584.75 g/mol. Its IUPAC name is (2S)-2-[1-[9-[2-[(1S)-1-carboxyethyl]-6-methoxynaphthalen-1-yl]nonyl]-6-methoxynaphthalen-2-yl]propanoic acid.
| Compound Name | (2S)-2-[1-[9-[2-[(1S)-1-carboxyethyl]-6-methoxynaphthalen-1-yl]nonyl]-6-methoxynaphthalen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 178182940 |
| Molecular Formula | C37H44O6 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | (2S)-2-[1-[9-[2-[(1S)-1-carboxyethyl]-6-methoxynaphthalen-1-yl]nonyl]-6-methoxynaphthalen-2-yl]propanoic acid |
| SMILES | COc1ccc2c(CCCCCCCCCc3c([C@H](C)C(=O)O)ccc4cc(OC)ccc34)c([C@H](C)C(=O)O)ccc2c1 |
| InChI | InChI=1S/C37H44O6/c1-24(36(38)39)30-18-14-26-22-28(42-3)16-20-32(26)34(30)12-10-8-6-5-7-9-11-13-35-31(25(2)37(40)41)19-15-27-23-29(43-4)17-21-33(27)35/h14-25H,5-13H2,1-4H3,(H,38,39)(H,40,41)/t24-,25-/m0/s1 |
| InChIKey | QAVJJWYUEBBILB-DQEYMECFSA-N |
| XLogP | 8.90 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|