C28H31BrO2 — CID 159211827
1-bromo-5-[4-[(1R,2S)-6-methyl-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentan-2-ol (PubChem CID 159211827) has the molecular formula C28H31BrO2 and a molecular weight of 479.46 g/mol. Its IUPAC name is 1-bromo-5-[4-[(1R,2S)-6-methyl-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentan-2-ol.
| Compound Name | 1-bromo-5-[4-[(1R,2S)-6-methyl-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentan-2-ol |
|---|---|
| PubChem CID | 159211827 |
| Molecular Formula | C28H31BrO2 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 1-bromo-5-[4-[(1R,2S)-6-methyl-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentan-2-ol |
| SMILES | Cc1ccc2c(c1)CC[C@H](c1ccccc1)[C@@H]2c1ccc(OCCCC(O)CBr)cc1 |
| InChI | InChI=1S/C28H31BrO2/c1-20-9-15-27-23(18-20)12-16-26(21-6-3-2-4-7-21)28(27)22-10-13-25(14-11-22)31-17-5-8-24(30)19-29/h2-4,6-7,9-11,13-15,18,24,26,28,30H,5,8,12,16-17,19H2,1H3/t24?,26-,28+/m1/s1 |
| InChIKey | JZNTWHPSEANCAI-FKJWPSLMSA-N |
| XLogP | 6.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|