C34H36O4 — CID 134580274
5-[4-[(1R,2S)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentane-1,3-diol (PubChem CID 134580274) has the molecular formula C34H36O4 and a molecular weight of 508.66 g/mol. Its IUPAC name is 5-[4-[(1R,2S)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentane-1,3-diol.
| Compound Name | 5-[4-[(1R,2S)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentane-1,3-diol |
|---|---|
| PubChem CID | 134580274 |
| Molecular Formula | C34H36O4 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 5-[4-[(1R,2S)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentane-1,3-diol |
| SMILES | OCCC(O)CCOc1ccc([C@@H]2c3ccc(OCc4ccccc4)cc3CC[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C34H36O4/c35-21-19-29(36)20-22-37-30-14-11-27(12-15-30)34-32(26-9-5-2-6-10-26)17-13-28-23-31(16-18-33(28)34)38-24-25-7-3-1-4-8-25/h1-12,14-16,18,23,29,32,34-36H,13,17,19-22,24H2/t29?,32-,34+/m1/s1 |
| InChIKey | MKLPURLXMKMIDU-TXIRIPORSA-N |
| XLogP | 6.64 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |