C35H36FNO2 — CID 134579644
[4-fluoro-1-[4-[(1R,2S)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidin-4-yl]methanol (PubChem CID 134579644) has the molecular formula C35H36FNO2 and a molecular weight of 521.68 g/mol. Its IUPAC name is [4-fluoro-1-[4-[(1R,2S)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidin-4-yl]methanol.
| Compound Name | [4-fluoro-1-[4-[(1R,2S)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 134579644 |
| Molecular Formula | C35H36FNO2 |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | [4-fluoro-1-[4-[(1R,2S)-2-phenyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidin-4-yl]methanol |
| SMILES | OCC1(F)CCN(c2ccc([C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@@H]3c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C35H36FNO2/c36-35(25-38)19-21-37(22-20-35)30-14-11-28(12-15-30)34-32(27-9-5-2-6-10-27)17-13-29-23-31(16-18-33(29)34)39-24-26-7-3-1-4-8-26/h1-12,14-16,18,23,32,34,38H,13,17,19-22,24-25H2/t32-,34+/m1/s1 |
| InChIKey | RHODSWVEYREWHM-CWTKIQHKSA-N |
| XLogP | 7.43 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|