C37H41F2NO — CID 142368158
fluoromethane;1-[4-[(2S)-2-(4-fluorophenyl)-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]-4-methylidenepiperidine;methane (PubChem CID 142368158) has the molecular formula C37H41F2NO and a molecular weight of 553.74 g/mol. Its IUPAC name is fluoromethane;1-[4-[(2S)-2-(4-fluorophenyl)-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]-4-methylidenepiperidine;methane.
| Compound Name | fluoromethane;1-[4-[(2S)-2-(4-fluorophenyl)-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]-4-methylidenepiperidine;methane |
|---|---|
| PubChem CID | 142368158 |
| Molecular Formula | C37H41F2NO |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | fluoromethane;1-[4-[(2S)-2-(4-fluorophenyl)-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]-4-methylidenepiperidine;methane |
| SMILES | C.C=C1CCN(c2ccc(C3c4ccc(OCc5ccccc5)cc4CC[C@@H]3c3ccc(F)cc3)cc2)CC1.CF |
| InChI | InChI=1S/C35H34FNO.CH3F.CH4/c1-25-19-21-37(22-20-25)31-14-9-28(10-15-31)35-33(27-7-12-30(36)13-8-27)17-11-29-23-32(16-18-34(29)35)38-24-26-5-3-2-4-6-26;1-2;/h2-10,12-16,18,23,33,35H,1,11,17,19-22,24H2;1H3;1H4/t33-,35?;;/m1../s1 |
| InChIKey | CVUIKFGNTRVVPK-WBAMJRSJSA-N |
| XLogP | 9.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|