C32H43NO4 — CID 142368171
2,2-dimethoxyethanol;ethane;(5R,6S)-6-phenyl-5-(4-pyrrolidin-1-ylphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 142368171) has the molecular formula C32H43NO4 and a molecular weight of 505.70 g/mol. Its IUPAC name is 2,2-dimethoxyethanol;ethane;(5R,6S)-6-phenyl-5-(4-pyrrolidin-1-ylphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 2,2-dimethoxyethanol;ethane;(5R,6S)-6-phenyl-5-(4-pyrrolidin-1-ylphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 142368171 |
| Molecular Formula | C32H43NO4 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | 2,2-dimethoxyethanol;ethane;(5R,6S)-6-phenyl-5-(4-pyrrolidin-1-ylphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | CC.COC(CO)OC.Oc1ccc2c(c1)CC[C@H](c1ccccc1)[C@@H]2c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C26H27NO.C4H10O3.C2H6/c28-23-13-15-25-21(18-23)10-14-24(19-6-2-1-3-7-19)26(25)20-8-11-22(12-9-20)27-16-4-5-17-27;1-6-4(3-5)7-2;1-2/h1-3,6-9,11-13,15,18,24,26,28H,4-5,10,14,16-17H2;4-5H,3H2,1-2H3;1-2H3/t24-,26+;;/m1../s1 |
| InChIKey | NOUIZGBIERYDGI-RUOOAJOPSA-N |
| XLogP | 6.48 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|