C38H49NO4 — CID 134583005
tert-butyl 4-[2-[4-[(1R,2S)-6-butoxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethyl]piperidine-1-carboxylate (PubChem CID 134583005) has the molecular formula C38H49NO4 and a molecular weight of 583.81 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-[(1R,2S)-6-butoxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-[(1R,2S)-6-butoxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134583005 |
| Molecular Formula | C38H49NO4 |
| Molecular Weight | 583.81 g/mol |
| Exact Mass | 583.37 |
| IUPAC Name | tert-butyl 4-[2-[4-[(1R,2S)-6-butoxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethyl]piperidine-1-carboxylate |
| SMILES | CCCCOc1ccc2c(c1)CC[C@H](c1ccccc1)[C@@H]2c1ccc(OCCC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C38H49NO4/c1-5-6-25-41-33-17-19-35-31(27-33)14-18-34(29-10-8-7-9-11-29)36(35)30-12-15-32(16-13-30)42-26-22-28-20-23-39(24-21-28)37(40)43-38(2,3)4/h7-13,15-17,19,27-28,34,36H,5-6,14,18,20-26H2,1-4H3/t34-,36+/m1/s1 |
| InChIKey | JAKIQKRMPIPOGJ-VHFKIGOXSA-N |
| XLogP | 9.14 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.81 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|