C29H28O3 — CID 158870412
2-[3-[4-[(1R,2S)-6-methyl-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]cyclobutylidene]acetic acid (PubChem CID 158870412) has the molecular formula C29H28O3 and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-[3-[4-[(1R,2S)-6-methyl-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]cyclobutylidene]acetic acid.
| Compound Name | 2-[3-[4-[(1R,2S)-6-methyl-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]cyclobutylidene]acetic acid |
|---|---|
| PubChem CID | 158870412 |
| Molecular Formula | C29H28O3 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2-[3-[4-[(1R,2S)-6-methyl-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]cyclobutylidene]acetic acid |
| SMILES | Cc1ccc2c(c1)CC[C@H](c1ccccc1)[C@@H]2c1ccc(OC2CC(=CC(=O)O)C2)cc1 |
| InChI | InChI=1S/C29H28O3/c1-19-7-13-27-23(15-19)10-14-26(21-5-3-2-4-6-21)29(27)22-8-11-24(12-9-22)32-25-16-20(17-25)18-28(30)31/h2-9,11-13,15,18,25-26,29H,10,14,16-17H2,1H3,(H,30,31)/b20-18-/t25?,26-,29+/m1/s1 |
| InChIKey | IMENMHVLOYZYLE-XMCNIHHFSA-N |
| XLogP | 6.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|