C31H35NO2U — CID 163585160
(5R)-5-(4-cyclobutyloxyphenyl)-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol;piperidin-4-ide;uranium(2+) (PubChem CID 163585160) has the molecular formula C31H35NO2U and a molecular weight of 691.66 g/mol. Its IUPAC name is (5R)-5-(4-cyclobutyloxyphenyl)-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol;piperidin-4-ide;uranium(2+).
| Compound Name | (5R)-5-(4-cyclobutyloxyphenyl)-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol;piperidin-4-ide;uranium(2+) |
|---|---|
| PubChem CID | 163585160 |
| Molecular Formula | C31H35NO2U |
| Molecular Weight | 691.66 g/mol |
| Exact Mass | 691.32 |
| IUPAC Name | (5R)-5-(4-cyclobutyloxyphenyl)-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol;piperidin-4-ide;uranium(2+) |
| SMILES | Oc1ccc2c(c1)CCC(c1ccccc1)[C@@H]2c1ccc(OC2C[CH-]C2)cc1.[CH-]1CCNCC1.[U+2] |
| InChI | InChI=1S/C26H25O2.C5H10N.U/c27-21-12-16-25-20(17-21)11-15-24(18-5-2-1-3-6-18)26(25)19-9-13-23(14-10-19)28-22-7-4-8-22;1-2-4-6-5-3-1;/h1-6,9-10,12-14,16-17,22,24,26-27H,7-8,11,15H2;1,6H,2-5H2;/q2*-1;+2/t24?,26-;;/m0../s1 |
| InChIKey | KVCVJNYXGSWAAA-RXCAMRGOSA-N |
| XLogP | 6.57 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.66 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|