C26H30O3 — CID 142368771
2-[4-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]acetaldehyde;methanol (PubChem CID 142368771) has the molecular formula C26H30O3 and a molecular weight of 390.52 g/mol. Its IUPAC name is 2-[4-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]acetaldehyde;methanol.
| Compound Name | 2-[4-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]acetaldehyde;methanol |
|---|---|
| PubChem CID | 142368771 |
| Molecular Formula | C26H30O3 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 2-[4-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]acetaldehyde;methanol |
| SMILES | C=C/C=C\C(=C/C)C1CCc2ccccc2C1c1ccc(OCC=O)cc1.CO |
| InChI | InChI=1S/C25H26O2.CH4O/c1-3-5-8-19(4-2)24-16-13-20-9-6-7-10-23(20)25(24)21-11-14-22(15-12-21)27-18-17-26;1-2/h3-12,14-15,17,24-25H,1,13,16,18H2,2H3;2H,1H3/b8-5-,19-4+; |
| InChIKey | KYSNLXUYNYCTET-YUNBDOOVSA-N |
| XLogP | 5.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|