C18H21NO2 — CID 146639747
5-[4-(2-aminoethoxy)phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 146639747) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 5-[4-(2-aminoethoxy)phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 5-[4-(2-aminoethoxy)phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 146639747 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 5-[4-(2-aminoethoxy)phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | NCCOc1ccc(C2CCCc3cc(O)ccc32)cc1 |
| InChI | InChI=1S/C18H21NO2/c19-10-11-21-16-7-4-13(5-8-16)17-3-1-2-14-12-15(20)6-9-18(14)17/h4-9,12,17,20H,1-3,10-11,19H2 |
| InChIKey | YIXARBZNOSJNJL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |