C31H34N2O3 — CID 164924450
2-[2-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]-2,8-diazaspiro[3.5]nonan-8-yl]acetic acid (PubChem CID 164924450) has the molecular formula C31H34N2O3 and a molecular weight of 482.62 g/mol. Its IUPAC name is 2-[2-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]-2,8-diazaspiro[3.5]nonan-8-yl]acetic acid.
| Compound Name | 2-[2-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]-2,8-diazaspiro[3.5]nonan-8-yl]acetic acid |
|---|---|
| PubChem CID | 164924450 |
| Molecular Formula | C31H34N2O3 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 2-[2-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]-2,8-diazaspiro[3.5]nonan-8-yl]acetic acid |
| SMILES | O=C(O)CN1CCCC2(C1)CN(c1ccc([C@@H]3c4ccc(O)cc4CC[C@@H]3c3ccccc3)cc1)C2 |
| InChI | InChI=1S/C31H34N2O3/c34-26-12-14-28-24(17-26)9-13-27(22-5-2-1-3-6-22)30(28)23-7-10-25(11-8-23)33-20-31(21-33)15-4-16-32(19-31)18-29(35)36/h1-3,5-8,10-12,14,17,27,30,34H,4,9,13,15-16,18-21H2,(H,35,36)/t27-,30+/m1/s1 |
| InChIKey | IGQHMHRJRHJSPC-OFSOJUDTSA-N |
| XLogP | 5.24 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|