C35H43NO4 — CID 170729570
(7R)-7-(dimethoxymethyl)-2-[4-[(1R,2S)-6-[(2-methylpropan-2-yl)oxy]-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]-5-oxa-2-azaspiro[3.4]octane (PubChem CID 170729570) has the molecular formula C35H43NO4 and a molecular weight of 541.73 g/mol. Its IUPAC name is (7R)-7-(dimethoxymethyl)-2-[4-[(1R,2S)-6-[(2-methylpropan-2-yl)oxy]-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]-5-oxa-2-azaspiro[3.4]octane.
| Compound Name | (7R)-7-(dimethoxymethyl)-2-[4-[(1R,2S)-6-[(2-methylpropan-2-yl)oxy]-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]-5-oxa-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 170729570 |
| Molecular Formula | C35H43NO4 |
| Molecular Weight | 541.73 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | (7R)-7-(dimethoxymethyl)-2-[4-[(1R,2S)-6-[(2-methylpropan-2-yl)oxy]-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]-5-oxa-2-azaspiro[3.4]octane |
| SMILES | COC(OC)[C@H]1COC2(C1)CN(c1ccc([C@@H]3c4ccc(OC(C)(C)C)cc4CC[C@@H]3c3ccccc3)cc1)C2 |
| InChI | InChI=1S/C35H43NO4/c1-34(2,3)40-29-16-18-31-26(19-29)13-17-30(24-9-7-6-8-10-24)32(31)25-11-14-28(15-12-25)36-22-35(23-36)20-27(21-39-35)33(37-4)38-5/h6-12,14-16,18-19,27,30,32-33H,13,17,20-23H2,1-5H3/t27-,30-,32+/m1/s1 |
| InChIKey | SADRCNPTFIWRIX-VUSUJWAUSA-N |
| XLogP | 6.94 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.73 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|