C40H43N3O5 — CID 142367832
2-formyl-4-[4-hydroxy-4-[[4-[4-[(1R)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperazin-1-yl]methyl]piperidin-1-yl]benzoic acid (PubChem CID 142367832) has the molecular formula C40H43N3O5 and a molecular weight of 645.80 g/mol. Its IUPAC name is 2-formyl-4-[4-hydroxy-4-[[4-[4-[(1R)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperazin-1-yl]methyl]piperidin-1-yl]benzoic acid.
| Compound Name | 2-formyl-4-[4-hydroxy-4-[[4-[4-[(1R)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperazin-1-yl]methyl]piperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 142367832 |
| Molecular Formula | C40H43N3O5 |
| Molecular Weight | 645.80 g/mol |
| Exact Mass | 645.32 |
| IUPAC Name | 2-formyl-4-[4-hydroxy-4-[[4-[4-[(1R)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperazin-1-yl]methyl]piperidin-1-yl]benzoic acid |
| SMILES | O=Cc1cc(N2CCC(O)(CN3CCN(c4ccc([C@@H]5c6ccc(O)cc6CCC5c5ccccc5)cc4)CC3)CC2)ccc1C(=O)O |
| InChI | InChI=1S/C40H43N3O5/c44-26-31-24-33(11-14-37(31)39(46)47)42-18-16-40(48,17-19-42)27-41-20-22-43(23-21-41)32-9-6-29(7-10-32)38-35(28-4-2-1-3-5-28)13-8-30-25-34(45)12-15-36(30)38/h1-7,9-12,14-15,24-26,35,38,45,48H,8,13,16-23,27H2,(H,46,47)/t35?,38-/m0/s1 |
| InChIKey | DOQRAHBZZGOZDV-SHXCFHCCSA-N |
| XLogP | 5.92 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.80 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|