C40H49N3O4 — CID 171785629
trans-(1S,2S)-2-[4-[[1-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidin-4-yl]methyl]piperazine-1-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 171785629) has the molecular formula C40H49N3O4 and a molecular weight of 635.85 g/mol. Its IUPAC name is trans-(1S,2S)-2-[4-[[1-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidin-4-yl]methyl]piperazine-1-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-2-[4-[[1-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidin-4-yl]methyl]piperazine-1-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 171785629 |
| Molecular Formula | C40H49N3O4 |
| Molecular Weight | 635.85 g/mol |
| Exact Mass | 635.37 |
| IUPAC Name | trans-(1S,2S)-2-[4-[[1-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidin-4-yl]methyl]piperazine-1-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCC[C@@H]1C(=O)N1CCN(CC2CCN(c3ccc([C@@H]4c5ccc(O)cc5CC[C@@H]4c4ccccc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C40H49N3O4/c44-33-15-17-35-31(26-33)12-16-34(29-6-2-1-3-7-29)38(35)30-10-13-32(14-11-30)42-20-18-28(19-21-42)27-41-22-24-43(25-23-41)39(45)36-8-4-5-9-37(36)40(46)47/h1-3,6-7,10-11,13-15,17,26,28,34,36-38,44H,4-5,8-9,12,16,18-25,27H2,(H,46,47)/t34-,36+,37+,38+/m1/s1 |
| InChIKey | SAJPRVOZFHTVFK-MSROBXDBSA-N |
| XLogP | 6.51 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.85 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|