C34H39ClF2N4O5 — CID 166564759
tert-butyl (4R,7R)-16-chloro-14-fluoro-15-[2-fluoro-6-(7-oxoheptoxy)phenyl]-4,9-dimethyl-8-oxo-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate (PubChem CID 166564759) has the molecular formula C34H39ClF2N4O5 and a molecular weight of 657.16 g/mol. Its IUPAC name is tert-butyl (4R,7R)-16-chloro-14-fluoro-15-[2-fluoro-6-(7-oxoheptoxy)phenyl]-4,9-dimethyl-8-oxo-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate.
| Compound Name | tert-butyl (4R,7R)-16-chloro-14-fluoro-15-[2-fluoro-6-(7-oxoheptoxy)phenyl]-4,9-dimethyl-8-oxo-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 166564759 |
| Molecular Formula | C34H39ClF2N4O5 |
| Molecular Weight | 657.16 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | tert-butyl (4R,7R)-16-chloro-14-fluoro-15-[2-fluoro-6-(7-oxoheptoxy)phenyl]-4,9-dimethyl-8-oxo-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate |
| SMILES | C[C@@H]1CN2c3c(cnc4c(F)c(-c5c(F)cccc5OCCCCCCC=O)c(Cl)cc34)N(C)C(=O)[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H39ClF2N4O5/c1-20-18-41-25(19-40(20)33(44)46-34(2,3)4)32(43)39(5)24-17-38-30-21(31(24)41)16-22(35)27(29(30)37)28-23(36)12-11-13-26(28)45-15-10-8-6-7-9-14-42/h11-14,16-17,20,25H,6-10,15,18-19H2,1-5H3/t20-,25-/m1/s1 |
| InChIKey | JQHMLERXPLARNA-CJFMBICVSA-N |
| XLogP | 7.15 |
| TPSA | 92.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.16 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|