C28H29ClF2N4O7 — CID 138721001
1-O-tert-butyl 3-O-methyl (3R,6R)-4-[6-chloro-8-fluoro-7-(2-fluoro-6-methoxyphenyl)-3-nitroquinolin-4-yl]-6-methylpiperazine-1,3-dicarboxylate (PubChem CID 138721001) has the molecular formula C28H29ClF2N4O7 and a molecular weight of 607.01 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl (3R,6R)-4-[6-chloro-8-fluoro-7-(2-fluoro-6-methoxyphenyl)-3-nitroquinolin-4-yl]-6-methylpiperazine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl (3R,6R)-4-[6-chloro-8-fluoro-7-(2-fluoro-6-methoxyphenyl)-3-nitroquinolin-4-yl]-6-methylpiperazine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 138721001 |
| Molecular Formula | C28H29ClF2N4O7 |
| Molecular Weight | 607.01 g/mol |
| Exact Mass | 606.17 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl (3R,6R)-4-[6-chloro-8-fluoro-7-(2-fluoro-6-methoxyphenyl)-3-nitroquinolin-4-yl]-6-methylpiperazine-1,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1CN(C(=O)OC(C)(C)C)[C@H](C)CN1c1c([N+](=O)[O-])cnc2c(F)c(-c3c(F)cccc3OC)c(Cl)cc12 |
| InChI | InChI=1S/C28H29ClF2N4O7/c1-14-12-34(19(26(36)41-6)13-33(14)27(37)42-28(2,3)4)25-15-10-16(29)21(22-17(30)8-7-9-20(22)40-5)23(31)24(15)32-11-18(25)35(38)39/h7-11,14,19H,12-13H2,1-6H3/t14-,19-/m1/s1 |
| InChIKey | DKVDUQWKYSRJLX-AUUYWEPGSA-N |
| XLogP | 5.74 |
| TPSA | 124.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.01 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|