C21H25ClFN5O8S — CID 175965542
1-O-tert-butyl 3-O-methyl (3S,6R)-4-(7-chloro-8-fluoro-3-nitro-1,6-naphthyridin-4-yl)-6-(methylsulfonylmethyl)piperazine-1,3-dicarboxylate (PubChem CID 175965542) has the molecular formula C21H25ClFN5O8S and a molecular weight of 561.98 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl (3S,6R)-4-(7-chloro-8-fluoro-3-nitro-1,6-naphthyridin-4-yl)-6-(methylsulfonylmethyl)piperazine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl (3S,6R)-4-(7-chloro-8-fluoro-3-nitro-1,6-naphthyridin-4-yl)-6-(methylsulfonylmethyl)piperazine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 175965542 |
| Molecular Formula | C21H25ClFN5O8S |
| Molecular Weight | 561.98 g/mol |
| Exact Mass | 561.11 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl (3S,6R)-4-(7-chloro-8-fluoro-3-nitro-1,6-naphthyridin-4-yl)-6-(methylsulfonylmethyl)piperazine-1,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CN(C(=O)OC(C)(C)C)[C@@H](CS(C)(=O)=O)CN1c1c([N+](=O)[O-])cnc2c(F)c(Cl)ncc12 |
| InChI | InChI=1S/C21H25ClFN5O8S/c1-21(2,3)36-20(30)26-9-14(19(29)35-4)27(8-11(26)10-37(5,33)34)17-12-6-25-18(22)15(23)16(12)24-7-13(17)28(31)32/h6-7,11,14H,8-10H2,1-5H3/t11-,14+/m1/s1 |
| InChIKey | WVNPBEAZFYLQAS-RISCZKNCSA-N |
| XLogP | 2.34 |
| TPSA | 162.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.98 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|