C19H19ClF4N6O2 — CID 155629936
tert-butyl (2R)-4-[7-chloro-8-fluoro-2-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazine-1-carboxylate (PubChem CID 155629936) has the molecular formula C19H19ClF4N6O2 and a molecular weight of 474.85 g/mol. Its IUPAC name is tert-butyl (2R)-4-[7-chloro-8-fluoro-2-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-[7-chloro-8-fluoro-2-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155629936 |
| Molecular Formula | C19H19ClF4N6O2 |
| Molecular Weight | 474.85 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | tert-butyl (2R)-4-[7-chloro-8-fluoro-2-(trifluoromethyl)pyrido[4,3-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazine-1-carboxylate |
| SMILES | [C-]#[N+]C[C@H]1CN(c2nc(C(F)(F)F)nc3c(F)c(Cl)ncc23)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H19ClF4N6O2/c1-18(2,3)32-17(31)30-6-5-29(9-10(30)7-25-4)15-11-8-26-14(20)12(21)13(11)27-16(28-15)19(22,23)24/h8,10H,5-7,9H2,1-3H3/t10-/m0/s1 |
| InChIKey | RINLYNDKGYUJJB-JTQLQIEISA-N |
| XLogP | 4.18 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.85 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|