C52H52Cl2F4N6O8 — CID 159252985
tert-butyl (7R)-16-chloro-14-fluoro-15-(2-fluoro-6-methoxyphenyl)-9-oxa-2,5,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate (PubChem CID 159252985) has the molecular formula C52H52Cl2F4N6O8 and a molecular weight of 1035.92 g/mol. Its IUPAC name is tert-butyl (7R)-16-chloro-14-fluoro-15-(2-fluoro-6-methoxyphenyl)-9-oxa-2,5,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate.
| Compound Name | tert-butyl (7R)-16-chloro-14-fluoro-15-(2-fluoro-6-methoxyphenyl)-9-oxa-2,5,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 159252985 |
| Molecular Formula | C52H52Cl2F4N6O8 |
| Molecular Weight | 1035.92 g/mol |
| Exact Mass | 1034.32 |
| IUPAC Name | tert-butyl (7R)-16-chloro-14-fluoro-15-(2-fluoro-6-methoxyphenyl)-9-oxa-2,5,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),11,13,15,17-pentaene-5-carboxylate |
| SMILES | COc1cccc(F)c1-c1c(Cl)cc2c3c(cnc2c1F)OC[C@H]1CN(C(=O)OC(C)(C)C)CCN31.COc1cccc(F)c1-c1c(Cl)cc2c3c(cnc2c1F)OC[C@H]1CN(C(=O)OC(C)(C)C)CCN31 |
| InChI | InChI=1S/2C26H26ClF2N3O4/c2*1-26(2,3)36-25(33)31-8-9-32-14(12-31)13-35-19-11-30-23-15(24(19)32)10-16(27)20(22(23)29)21-17(28)6-5-7-18(21)34-4/h2*5-7,10-11,14H,8-9,12-13H2,1-4H3/t2*14-/m11/s1 |
| InChIKey | KVNPDZFSFHMBQJ-RPERETBRSA-N |
| XLogP | 11.32 |
| TPSA | 128.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.92 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |